About ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate
ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate (PubChem CID 167040213) has the molecular formula C22H21F2NO3
and a molecular weight of 385.41 g/mol. Its IUPAC name is ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate |
| PubChem CID | 167040213 |
| Molecular Formula | C22H21F2NO3 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1C/C(=C\c2ccccc2F)C(O)/C(=C/c2ccccc2F)C1 |
| InChI | InChI=1S/C22H21F2NO3/c1-2-28-22(27)25-13-17(11-15-7-3-5-9-19(15)23)21(26)18(14-25)12-16-8-4-6-10-20(16)24/h3-12,21,26H,2,13-14H2,1H3/b17-11+,18-12+ |
| InChIKey | BBWDZGSQAPOKEW-JYFOCSDGSA-N |
| XLogP | 4.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate?
The IUPAC name of ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate (CID 167040213) is ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate.
What is the SMILES notation for ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate?
The canonical SMILES for ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate is CCOC(=O)N1C/C(=C\c2ccccc2F)C(O)/C(=C/c2ccccc2F)C1.
What is the InChIKey of ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate?
The InChIKey is BBWDZGSQAPOKEW-JYFOCSDGSA-N. The full InChI is InChI=1S/C22H21F2NO3/c1-2-28-22(27)25-13-17(11-15-7-3-5-9-19(15)23)21(26)18(14-25)12-16-8-4-6-10-20(16)24/h3-12,21,26H,2,13-14H2,1H3/b17-11+,18-12+.
What are the key properties of ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate?
ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate has a molecular weight of 385.41 g/mol, XLogP of 4.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-4-hydroxypiperidine-1-carboxylate is sourced from PubChem (CID 167040213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).