C9H13F3OS — CID 167040300
(2Z,4E)-3-methyl-4-(2,2,2-trifluoroethylsulfinyl)hexa-2,4-diene (PubChem CID 167040300) has the molecular formula C9H13F3OS and a molecular weight of 226.26 g/mol. Its IUPAC name is (2Z,4E)-3-methyl-4-(2,2,2-trifluoroethylsulfinyl)hexa-2,4-diene.
| Compound Name | (2Z,4E)-3-methyl-4-(2,2,2-trifluoroethylsulfinyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 167040300 |
| Molecular Formula | C9H13F3OS |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (2Z,4E)-3-methyl-4-(2,2,2-trifluoroethylsulfinyl)hexa-2,4-diene |
| SMILES | C/C=C(C)\C(=C/C)S(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H13F3OS/c1-4-7(3)8(5-2)14(13)6-9(10,11)12/h4-5H,6H2,1-3H3/b7-4-,8-5+ |
| InChIKey | AXJHNXIQNNTIIY-DKBJKEKUSA-N |
| XLogP | 3.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|