C29H34N8O3S — CID 167040404
2-[[5-(2,7-diazaspiro[3.4]octan-2-yl)-2-pyridinyl]amino]sulfanyl-7-[4-(2-methoxyethoxy)phenyl]-N,N-dimethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 167040404) has the molecular formula C29H34N8O3S and a molecular weight of 574.71 g/mol. Its IUPAC name is 2-[[5-(2,7-diazaspiro[3.4]octan-2-yl)-2-pyridinyl]amino]sulfanyl-7-[4-(2-methoxyethoxy)phenyl]-N,N-dimethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 2-[[5-(2,7-diazaspiro[3.4]octan-2-yl)-2-pyridinyl]amino]sulfanyl-7-[4-(2-methoxyethoxy)phenyl]-N,N-dimethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 167040404 |
| Molecular Formula | C29H34N8O3S |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 2-[[5-(2,7-diazaspiro[3.4]octan-2-yl)-2-pyridinyl]amino]sulfanyl-7-[4-(2-methoxyethoxy)phenyl]-N,N-dimethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | COCCOc1ccc(-c2c(C(=O)N(C)C)cc3cnc(SNc4ccc(N5CC6(CCNC6)C5)cn4)nn23)cc1 |
| InChI | InChI=1S/C29H34N8O3S/c1-35(2)27(38)24-14-22-16-32-28(33-37(22)26(24)20-4-7-23(8-5-20)40-13-12-39-3)41-34-25-9-6-21(15-31-25)36-18-29(19-36)10-11-30-17-29/h4-9,14-16,30H,10-13,17-19H2,1-3H3,(H,31,34) |
| InChIKey | ZDZQWCDDTBXZPG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|