About (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol
(4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol (PubChem CID 167040438) has the molecular formula C8H13BrN2O2
and a molecular weight of 249.11 g/mol. Its IUPAC name is (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol.
Molecular Properties
| Compound Name | (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol |
| PubChem CID | 167040438 |
| Molecular Formula | C8H13BrN2O2 |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol |
| SMILES | CCOC(O)c1nn(C)c(C)c1Br |
| InChI | InChI=1S/C8H13BrN2O2/c1-4-13-8(12)7-6(9)5(2)11(3)10-7/h8,12H,4H2,1-3H3 |
| InChIKey | OEPYABMTQDQOCV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol?
The IUPAC name of (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol (CID 167040438) is (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol.
What is the SMILES notation for (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol?
The canonical SMILES for (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol is CCOC(O)c1nn(C)c(C)c1Br.
What is the InChIKey of (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol?
The InChIKey is OEPYABMTQDQOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrN2O2/c1-4-13-8(12)7-6(9)5(2)11(3)10-7/h8,12H,4H2,1-3H3.
What are the key properties of (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol?
(4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol has a molecular weight of 249.11 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-1,5-dimethylpyrazol-3-yl)-ethoxymethanol is sourced from PubChem (CID 167040438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).