C20H31N — CID 167041049
3-[1-[(2E,4E)-4-tert-butylhexa-2,4-dien-2-yl]cyclopentyl]-2-methylidenebut-3-en-1-imine (PubChem CID 167041049) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is 3-[1-[(2E,4E)-4-tert-butylhexa-2,4-dien-2-yl]cyclopentyl]-2-methylidenebut-3-en-1-imine.
| Compound Name | 3-[1-[(2E,4E)-4-tert-butylhexa-2,4-dien-2-yl]cyclopentyl]-2-methylidenebut-3-en-1-imine |
|---|---|
| PubChem CID | 167041049 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 3-[1-[(2E,4E)-4-tert-butylhexa-2,4-dien-2-yl]cyclopentyl]-2-methylidenebut-3-en-1-imine |
| SMILES | [H]/N=C/C(=C)C(=C)C1(/C(C)=C/C(=C\C)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C20H31N/c1-8-18(19(5,6)7)13-16(3)20(11-9-10-12-20)17(4)15(2)14-21/h8,13-14,21H,2,4,9-12H2,1,3,5-7H3/b16-13+,18-8+,21-14+ |
| InChIKey | QWUUQGRCTRYZMG-OVPRWTQTSA-N |
| XLogP | 6.25 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|