About (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine
(2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine (PubChem CID 167041069) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine.
Molecular Properties
| Compound Name | (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine |
| PubChem CID | 167041069 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine |
| SMILES | C/C=C1/OC(C)=C(C)C(N)=C1C |
| InChI | InChI=1S/C10H15NO/c1-5-9-7(3)10(11)6(2)8(4)12-9/h5H,11H2,1-4H3/b9-5+ |
| InChIKey | UDZJMOKRTGPEJY-WEVVVXLNSA-N |
| XLogP | 2.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine?
The IUPAC name of (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine (CID 167041069) is (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine.
What is the SMILES notation for (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine?
The canonical SMILES for (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine is C/C=C1/OC(C)=C(C)C(N)=C1C.
What is the InChIKey of (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine?
The InChIKey is UDZJMOKRTGPEJY-WEVVVXLNSA-N. The full InChI is InChI=1S/C10H15NO/c1-5-9-7(3)10(11)6(2)8(4)12-9/h5H,11H2,1-4H3/b9-5+.
What are the key properties of (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine?
(2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine has a molecular weight of 165.24 g/mol, XLogP of 2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethylidene-3,5,6-trimethylpyran-4-amine is sourced from PubChem (CID 167041069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).