About 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine
5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine (PubChem CID 167041115) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine |
| PubChem CID | 167041115 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine |
| SMILES | C=C/N=C1\C=CC=C(C(C)(C)C)C1=C |
| InChI | InChI=1S/C13H17N/c1-6-14-12-9-7-8-11(10(12)2)13(3,4)5/h6-9H,1-2H2,3-5H3/b14-12+ |
| InChIKey | UVTJHXNEVFVPMJ-WYMLVPIESA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine?
The IUPAC name of 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine (CID 167041115) is 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine?
The canonical SMILES for 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine is C=C/N=C1\C=CC=C(C(C)(C)C)C1=C.
What is the InChIKey of 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine?
The InChIKey is UVTJHXNEVFVPMJ-WYMLVPIESA-N. The full InChI is InChI=1S/C13H17N/c1-6-14-12-9-7-8-11(10(12)2)13(3,4)5/h6-9H,1-2H2,3-5H3/b14-12+.
What are the key properties of 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine?
5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine has a molecular weight of 187.29 g/mol, XLogP of 3.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-N-ethenyl-6-methylidenecyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 167041115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).