About 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine
2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine (PubChem CID 167041150) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine.
Molecular Properties
| Compound Name | 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine |
| PubChem CID | 167041150 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine |
| SMILES | C=CC1(CC)C(C)C1NC |
| InChI | InChI=1S/C9H17N/c1-5-9(6-2)7(3)8(9)10-4/h5,7-8,10H,1,6H2,2-4H3 |
| InChIKey | NYYSKYAEKQNODR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine?
The IUPAC name of 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine (CID 167041150) is 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine.
What is the SMILES notation for 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine?
The canonical SMILES for 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine is C=CC1(CC)C(C)C1NC.
What is the InChIKey of 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine?
The InChIKey is NYYSKYAEKQNODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-5-9(6-2)7(3)8(9)10-4/h5,7-8,10H,1,6H2,2-4H3.
What are the key properties of 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine?
2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine has a molecular weight of 139.24 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-2-ethyl-N,3-dimethylcyclopropan-1-amine is sourced from PubChem (CID 167041150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).