About but-3-en-2-ylcarbamoyl acetate
but-3-en-2-ylcarbamoyl acetate (PubChem CID 167041603) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is but-3-en-2-ylcarbamoyl acetate.
Molecular Properties
| Compound Name | but-3-en-2-ylcarbamoyl acetate |
| PubChem CID | 167041603 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | but-3-en-2-ylcarbamoyl acetate |
| SMILES | C=CC(C)NC(=O)OC(C)=O |
| InChI | InChI=1S/C7H11NO3/c1-4-5(2)8-7(10)11-6(3)9/h4-5H,1H2,2-3H3,(H,8,10) |
| InChIKey | FGWNZNATUQYAIY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-ylcarbamoyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-ylcarbamoyl acetate?
The IUPAC name of but-3-en-2-ylcarbamoyl acetate (CID 167041603) is but-3-en-2-ylcarbamoyl acetate.
What is the SMILES notation for but-3-en-2-ylcarbamoyl acetate?
The canonical SMILES for but-3-en-2-ylcarbamoyl acetate is C=CC(C)NC(=O)OC(C)=O.
What is the InChIKey of but-3-en-2-ylcarbamoyl acetate?
The InChIKey is FGWNZNATUQYAIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4-5(2)8-7(10)11-6(3)9/h4-5H,1H2,2-3H3,(H,8,10).
What are the key properties of but-3-en-2-ylcarbamoyl acetate?
but-3-en-2-ylcarbamoyl acetate has a molecular weight of 157.17 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-ylcarbamoyl acetate is sourced from PubChem (CID 167041603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).