C22H34N2OS — CID 167042082
2-cyclohexylsulfanyl-5,7,9-trimethyl-1,3,8-trimethylidene-3a,4,5,9,10,10a-hexahydropyrrolo[3,4-e]azonin-6-one (PubChem CID 167042082) has the molecular formula C22H34N2OS and a molecular weight of 374.59 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-5,7,9-trimethyl-1,3,8-trimethylidene-3a,4,5,9,10,10a-hexahydropyrrolo[3,4-e]azonin-6-one.
| Compound Name | 2-cyclohexylsulfanyl-5,7,9-trimethyl-1,3,8-trimethylidene-3a,4,5,9,10,10a-hexahydropyrrolo[3,4-e]azonin-6-one |
|---|---|
| PubChem CID | 167042082 |
| Molecular Formula | C22H34N2OS |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 2-cyclohexylsulfanyl-5,7,9-trimethyl-1,3,8-trimethylidene-3a,4,5,9,10,10a-hexahydropyrrolo[3,4-e]azonin-6-one |
| SMILES | C=C1C(C)CC2C(=C)N(SC3CCCCC3)C(=C)C2CC(C)C(=O)N1C |
| InChI | InChI=1S/C22H34N2OS/c1-14-12-20-17(4)24(26-19-10-8-7-9-11-19)18(5)21(20)13-15(2)22(25)23(6)16(14)3/h14-15,19-21H,3-5,7-13H2,1-2,6H3 |
| InChIKey | YGLWYQFRNOHPQA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|