C15H26F2N2 — CID 167042433
N-[(Z)-5-(5,5-difluoro-1,3-dimethylpiperidin-2-yl)pent-2-en-3-yl]propan-1-imine (PubChem CID 167042433) has the molecular formula C15H26F2N2 and a molecular weight of 272.38 g/mol. Its IUPAC name is N-[(Z)-5-(5,5-difluoro-1,3-dimethylpiperidin-2-yl)pent-2-en-3-yl]propan-1-imine.
| Compound Name | N-[(Z)-5-(5,5-difluoro-1,3-dimethylpiperidin-2-yl)pent-2-en-3-yl]propan-1-imine |
|---|---|
| PubChem CID | 167042433 |
| Molecular Formula | C15H26F2N2 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | N-[(Z)-5-(5,5-difluoro-1,3-dimethylpiperidin-2-yl)pent-2-en-3-yl]propan-1-imine |
| SMILES | C/C=C(CCC1C(C)CC(F)(F)CN1C)\N=C\CC |
| InChI | InChI=1S/C15H26F2N2/c1-5-9-18-13(6-2)7-8-14-12(3)10-15(16,17)11-19(14)4/h6,9,12,14H,5,7-8,10-11H2,1-4H3/b13-6-,18-9+ |
| InChIKey | IOLWMJZSDOUDQH-RMSYFVAQSA-N |
| XLogP | 4.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|