C12H26GeN2 — CID 16704253
1,3-ditert-butyl-2,2-dimethyl-1,3,2-diazagermole (PubChem CID 16704253) has the molecular formula C12H26GeN2 and a molecular weight of 270.96 g/mol. Its IUPAC name is 1,3-ditert-butyl-2,2-dimethyl-1,3,2-diazagermole.
| Compound Name | 1,3-ditert-butyl-2,2-dimethyl-1,3,2-diazagermole |
|---|---|
| PubChem CID | 16704253 |
| Molecular Formula | C12H26GeN2 |
| Molecular Weight | 270.96 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1,3-ditert-butyl-2,2-dimethyl-1,3,2-diazagermole |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[Ge]1(C)C |
| InChI | InChI=1S/C12H26GeN2/c1-11(2,3)14-9-10-15(12(4,5)6)13(14,7)8/h9-10H,1-8H3 |
| InChIKey | BBOAUXVJOKFBJF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.96 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |