C30H27IN2O8 — CID 167045239
[5-[1-[4-(2,5-dioxopyrrol-1-yl)phenyl]-2-iodo-1-oxopropan-2-yl]oxy-2-methylpentan-2-yl] 4-(2,5-dioxopyrrol-1-yl)benzoate (PubChem CID 167045239) has the molecular formula C30H27IN2O8 and a molecular weight of 670.46 g/mol. Its IUPAC name is [5-[1-[4-(2,5-dioxopyrrol-1-yl)phenyl]-2-iodo-1-oxopropan-2-yl]oxy-2-methylpentan-2-yl] 4-(2,5-dioxopyrrol-1-yl)benzoate.
| Compound Name | [5-[1-[4-(2,5-dioxopyrrol-1-yl)phenyl]-2-iodo-1-oxopropan-2-yl]oxy-2-methylpentan-2-yl] 4-(2,5-dioxopyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 167045239 |
| Molecular Formula | C30H27IN2O8 |
| Molecular Weight | 670.46 g/mol |
| Exact Mass | 670.08 |
| IUPAC Name | [5-[1-[4-(2,5-dioxopyrrol-1-yl)phenyl]-2-iodo-1-oxopropan-2-yl]oxy-2-methylpentan-2-yl] 4-(2,5-dioxopyrrol-1-yl)benzoate |
| SMILES | CC(C)(CCCOC(C)(I)C(=O)c1ccc(N2C(=O)C=CC2=O)cc1)OC(=O)c1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C30H27IN2O8/c1-29(2,41-28(39)20-7-11-22(12-8-20)33-25(36)15-16-26(33)37)17-4-18-40-30(3,31)27(38)19-5-9-21(10-6-19)32-23(34)13-14-24(32)35/h5-16H,4,17-18H2,1-3H3 |
| InChIKey | RAHYSPUWIMHJPP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|