C18H28N2 — CID 167045478
(2Z,4Z,6E,8Z)-1-N,4,11-trimethyl-2-propan-2-yldodeca-2,4,6,8-tetraene-1,10-diimine (PubChem CID 167045478) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is (2Z,4Z,6E,8Z)-1-N,4,11-trimethyl-2-propan-2-yldodeca-2,4,6,8-tetraene-1,10-diimine.
| Compound Name | (2Z,4Z,6E,8Z)-1-N,4,11-trimethyl-2-propan-2-yldodeca-2,4,6,8-tetraene-1,10-diimine |
|---|---|
| PubChem CID | 167045478 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | (2Z,4Z,6E,8Z)-1-N,4,11-trimethyl-2-propan-2-yldodeca-2,4,6,8-tetraene-1,10-diimine |
| SMILES | [H]/N=C(/C=C\C=C\C=C(C)/C=C(\C=N\C)C(C)C)C(C)C |
| InChI | InChI=1S/C18H28N2/c1-14(2)17(13-20-6)12-16(5)10-8-7-9-11-18(19)15(3)4/h7-15,19H,1-6H3/b8-7+,11-9-,16-10-,17-12+,19-18-,20-13+ |
| InChIKey | OMJULOQENLNJIN-ZRADMPMBSA-N |
| XLogP | 5.00 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|