About 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol
2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol (PubChem CID 167045485) has the molecular formula C7H10FNO
and a molecular weight of 143.16 g/mol. Its IUPAC name is 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol |
| PubChem CID | 167045485 |
| Molecular Formula | C7H10FNO |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol |
| SMILES | NCC1=C(O)C=CC(F)C1 |
| InChI | InChI=1S/C7H10FNO/c8-6-1-2-7(10)5(3-6)4-9/h1-2,6,10H,3-4,9H2 |
| InChIKey | CVVRIIDIMROURM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol?
The IUPAC name of 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol (CID 167045485) is 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol?
The canonical SMILES for 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol is NCC1=C(O)C=CC(F)C1.
What is the InChIKey of 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol?
The InChIKey is CVVRIIDIMROURM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FNO/c8-6-1-2-7(10)5(3-6)4-9/h1-2,6,10H,3-4,9H2.
What are the key properties of 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol?
2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol has a molecular weight of 143.16 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-4-fluorocyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 167045485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).