C14H14O2S2 — CID 167045845
2,3-dimethyl-6,7,8,9-tetrahydrobenzo[g][1,4]benzodithiine-5,10-dione (PubChem CID 167045845) has the molecular formula C14H14O2S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2,3-dimethyl-6,7,8,9-tetrahydrobenzo[g][1,4]benzodithiine-5,10-dione.
| Compound Name | 2,3-dimethyl-6,7,8,9-tetrahydrobenzo[g][1,4]benzodithiine-5,10-dione |
|---|---|
| PubChem CID | 167045845 |
| Molecular Formula | C14H14O2S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2,3-dimethyl-6,7,8,9-tetrahydrobenzo[g][1,4]benzodithiine-5,10-dione |
| SMILES | Cc1sc2c(=O)c3c(c(=O)c=2sc1C)CCCC3 |
| InChI | InChI=1S/C14H14O2S2/c1-7-8(2)18-14-12(16)10-6-4-3-5-9(10)11(15)13(14)17-7/h3-6H2,1-2H3 |
| InChIKey | RDTXJGBMTRPIHP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|