About 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol
1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol (PubChem CID 167045982) has the molecular formula C10H18O2S3
and a molecular weight of 266.45 g/mol. Its IUPAC name is 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol.
Molecular Properties
| Compound Name | 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol |
| PubChem CID | 167045982 |
| Molecular Formula | C10H18O2S3 |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol |
| SMILES | C=C(C)C(O)OCCSCC1SCCS1 |
| InChI | InChI=1S/C10H18O2S3/c1-8(2)10(11)12-3-4-13-7-9-14-5-6-15-9/h9-11H,1,3-7H2,2H3 |
| InChIKey | VADVCWYYOXOVMB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol?
The IUPAC name of 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol (CID 167045982) is 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol.
What is the SMILES notation for 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol?
The canonical SMILES for 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol is C=C(C)C(O)OCCSCC1SCCS1.
What is the InChIKey of 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol?
The InChIKey is VADVCWYYOXOVMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2S3/c1-8(2)10(11)12-3-4-13-7-9-14-5-6-15-9/h9-11H,1,3-7H2,2H3.
What are the key properties of 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol?
1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol has a molecular weight of 266.45 g/mol, XLogP of 2.44, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-dithiolan-2-ylmethylsulfanyl)ethoxy]-2-methylprop-2-en-1-ol is sourced from PubChem (CID 167045982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).