C28H28N6O4 — CID 167046175
1-[6-(3-hydroxyoxetan-3-yl)-2-pyridinyl]-6-[4-(4-oxocyclohexyl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 167046175) has the molecular formula C28H28N6O4 and a molecular weight of 512.57 g/mol. Its IUPAC name is 1-[6-(3-hydroxyoxetan-3-yl)-2-pyridinyl]-6-[4-(4-oxocyclohexyl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[6-(3-hydroxyoxetan-3-yl)-2-pyridinyl]-6-[4-(4-oxocyclohexyl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 167046175 |
| Molecular Formula | C28H28N6O4 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 1-[6-(3-hydroxyoxetan-3-yl)-2-pyridinyl]-6-[4-(4-oxocyclohexyl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(C4CCC(=O)CC4)cc3)nc2n1-c1cccc(C2(O)COC2)n1 |
| InChI | InChI=1S/C28H28N6O4/c1-2-14-33-26(36)22-15-29-27(30-20-10-6-18(7-11-20)19-8-12-21(35)13-9-19)32-25(22)34(33)24-5-3-4-23(31-24)28(37)16-38-17-28/h2-7,10-11,15,19,37H,1,8-9,12-14,16-17H2,(H,29,30,32) |
| InChIKey | HJFIYFSOGFSHBP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|