C22H18Cl2N3O3PS — CID 167046190
5-chloro-4-(3-chloro-6-cyclohepta-1,4,6-trien-1-ylindazol-1-yl)-N-methylsulfonyl-2-phosphanylbenzamide (PubChem CID 167046190) has the molecular formula C22H18Cl2N3O3PS and a molecular weight of 506.35 g/mol. Its IUPAC name is 5-chloro-4-(3-chloro-6-cyclohepta-1,4,6-trien-1-ylindazol-1-yl)-N-methylsulfonyl-2-phosphanylbenzamide.
| Compound Name | 5-chloro-4-(3-chloro-6-cyclohepta-1,4,6-trien-1-ylindazol-1-yl)-N-methylsulfonyl-2-phosphanylbenzamide |
|---|---|
| PubChem CID | 167046190 |
| Molecular Formula | C22H18Cl2N3O3PS |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | 5-chloro-4-(3-chloro-6-cyclohepta-1,4,6-trien-1-ylindazol-1-yl)-N-methylsulfonyl-2-phosphanylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(Cl)c(-n2nc(Cl)c3ccc(C4=CCC=CC=C4)cc32)cc1P |
| InChI | InChI=1S/C22H18Cl2N3O3PS/c1-32(29,30)26-22(28)16-11-17(23)19(12-20(16)31)27-18-10-14(8-9-15(18)21(24)25-27)13-6-4-2-3-5-7-13/h2-4,6-12H,5,31H2,1H3,(H,26,28) |
| InChIKey | HPLJLMQKWIJMEQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|