C22H32F2N2 — CID 167046233
(3E,5E,7E,12Z)-3-(difluoromethyl)-N,N,6,7,14-pentamethyl-11-methyliminopentadeca-1,3,5,7,12,14-hexaen-8-amine (PubChem CID 167046233) has the molecular formula C22H32F2N2 and a molecular weight of 362.51 g/mol. Its IUPAC name is (3E,5E,7E,12Z)-3-(difluoromethyl)-N,N,6,7,14-pentamethyl-11-methyliminopentadeca-1,3,5,7,12,14-hexaen-8-amine.
| Compound Name | (3E,5E,7E,12Z)-3-(difluoromethyl)-N,N,6,7,14-pentamethyl-11-methyliminopentadeca-1,3,5,7,12,14-hexaen-8-amine |
|---|---|
| PubChem CID | 167046233 |
| Molecular Formula | C22H32F2N2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (3E,5E,7E,12Z)-3-(difluoromethyl)-N,N,6,7,14-pentamethyl-11-methyliminopentadeca-1,3,5,7,12,14-hexaen-8-amine |
| SMILES | C=C/C(=C\C=C(C)\C(C)=C(/CCC(/C=C\C(=C)C)=N\C)N(C)C)C(F)F |
| InChI | InChI=1S/C22H32F2N2/c1-9-19(22(23)24)12-11-17(4)18(5)21(26(7)8)15-14-20(25-6)13-10-16(2)3/h9-13,22H,1-2,14-15H2,3-8H3/b13-10-,17-11+,19-12+,21-18+,25-20- |
| InChIKey | BWHQDHZGISTQQA-SCTNNUKCSA-N |
| XLogP | 6.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|