C22H33FN2O — CID 167046260
(3Z,5Z,6E,9Z,11E)-11-N-butan-2-yl-5-[2-(2-fluoroethoxy)ethylidene]-8-methylidenetrideca-1,3,6,9,11-pentaene-2,11-diamine (PubChem CID 167046260) has the molecular formula C22H33FN2O and a molecular weight of 360.52 g/mol. Its IUPAC name is (3Z,5Z,6E,9Z,11E)-11-N-butan-2-yl-5-[2-(2-fluoroethoxy)ethylidene]-8-methylidenetrideca-1,3,6,9,11-pentaene-2,11-diamine.
| Compound Name | (3Z,5Z,6E,9Z,11E)-11-N-butan-2-yl-5-[2-(2-fluoroethoxy)ethylidene]-8-methylidenetrideca-1,3,6,9,11-pentaene-2,11-diamine |
|---|---|
| PubChem CID | 167046260 |
| Molecular Formula | C22H33FN2O |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (3Z,5Z,6E,9Z,11E)-11-N-butan-2-yl-5-[2-(2-fluoroethoxy)ethylidene]-8-methylidenetrideca-1,3,6,9,11-pentaene-2,11-diamine |
| SMILES | C=C(N)/C=C\C(=C/COCCF)\C=C\C(=C)/C=C\C(=C/C)NC(C)CC |
| InChI | InChI=1S/C22H33FN2O/c1-6-20(5)25-22(7-2)13-9-18(3)8-11-21(12-10-19(4)24)14-16-26-17-15-23/h7-14,20,25H,3-4,6,15-17,24H2,1-2,5H3/b11-8+,12-10-,13-9-,21-14-,22-7+ |
| InChIKey | YPYFOYOMMQTTHO-STSXMZBJSA-N |
| XLogP | 4.89 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|