About (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate
(5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate (PubChem CID 167046539) has the molecular formula C8H10FN2O6P
and a molecular weight of 280.15 g/mol. Its IUPAC name is (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate.
Molecular Properties
| Compound Name | (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate |
| PubChem CID | 167046539 |
| Molecular Formula | C8H10FN2O6P |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate |
| SMILES | C#CCOP(=O)(F)N(N)C(=O)OC1COC(=O)C1 |
| InChI | InChI=1S/C8H10FN2O6P/c1-2-3-16-18(9,14)11(10)8(13)17-6-4-7(12)15-5-6/h1,6H,3-5,10H2 |
| InChIKey | JFOGKFHOZFAWOP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate?
The IUPAC name of (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate (CID 167046539) is (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate.
What is the SMILES notation for (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate?
The canonical SMILES for (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate is C#CCOP(=O)(F)N(N)C(=O)OC1COC(=O)C1.
What is the InChIKey of (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate?
The InChIKey is JFOGKFHOZFAWOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN2O6P/c1-2-3-16-18(9,14)11(10)8(13)17-6-4-7(12)15-5-6/h1,6H,3-5,10H2.
What are the key properties of (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate?
(5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate has a molecular weight of 280.15 g/mol, XLogP of 0.34, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxooxolan-3-yl) N-amino-N-[fluoro(prop-2-ynoxy)phosphoryl]carbamate is sourced from PubChem (CID 167046539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).