About N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide
N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide (PubChem CID 167046616) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide |
| PubChem CID | 167046616 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide |
| SMILES | O=C(NCCO)C1=CCC=CC=C1 |
| InChI | InChI=1S/C10H13NO2/c12-8-7-11-10(13)9-5-3-1-2-4-6-9/h1-3,5-6,12H,4,7-8H2,(H,11,13) |
| InChIKey | RCMIAXJHQLNYDP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide?
The IUPAC name of N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide (CID 167046616) is N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide.
What is the SMILES notation for N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide?
The canonical SMILES for N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide is O=C(NCCO)C1=CCC=CC=C1.
What is the InChIKey of N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide?
The InChIKey is RCMIAXJHQLNYDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c12-8-7-11-10(13)9-5-3-1-2-4-6-9/h1-3,5-6,12H,4,7-8H2,(H,11,13).
What are the key properties of N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide?
N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide has a molecular weight of 179.22 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)cyclohepta-1,4,6-triene-1-carboxamide is sourced from PubChem (CID 167046616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).