C11H13F3N2O — CID 167046727
3-[(2R,3E,5Z)-4-(trifluoromethyl)octa-3,5-dien-2-yl]-1,2,4-oxadiazole (PubChem CID 167046727) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-[(2R,3E,5Z)-4-(trifluoromethyl)octa-3,5-dien-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[(2R,3E,5Z)-4-(trifluoromethyl)octa-3,5-dien-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 167046727 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-[(2R,3E,5Z)-4-(trifluoromethyl)octa-3,5-dien-2-yl]-1,2,4-oxadiazole |
| SMILES | CC/C=C\C(=C/[C@@H](C)c1ncon1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O/c1-3-4-5-9(11(12,13)14)6-8(2)10-15-7-17-16-10/h4-8H,3H2,1-2H3/b5-4-,9-6+/t8-/m1/s1 |
| InChIKey | NTTYECRRSKTFNO-GBXSPLGYSA-N |
| XLogP | 3.63 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|