C10H10FN3O — CID 167046844
fluoro-[5-(1,2,4-oxadiazol-3-yl)cyclohepta-1,4,6-trien-1-yl]methanamine (PubChem CID 167046844) has the molecular formula C10H10FN3O and a molecular weight of 207.21 g/mol. Its IUPAC name is fluoro-[5-(1,2,4-oxadiazol-3-yl)cyclohepta-1,4,6-trien-1-yl]methanamine.
| Compound Name | fluoro-[5-(1,2,4-oxadiazol-3-yl)cyclohepta-1,4,6-trien-1-yl]methanamine |
|---|---|
| PubChem CID | 167046844 |
| Molecular Formula | C10H10FN3O |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | fluoro-[5-(1,2,4-oxadiazol-3-yl)cyclohepta-1,4,6-trien-1-yl]methanamine |
| SMILES | NC(F)C1=CCC=C(c2ncon2)C=C1 |
| InChI | InChI=1S/C10H10FN3O/c11-9(12)7-2-1-3-8(5-4-7)10-13-6-15-14-10/h2-6,9H,1,12H2 |
| InChIKey | XFTFUXWRNBTXTE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|