C9H12N2O2 — CID 167046865
(2E,4E)-5-(1,2,4-oxadiazol-3-yl)hepta-2,4-dien-2-ol (PubChem CID 167046865) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (2E,4E)-5-(1,2,4-oxadiazol-3-yl)hepta-2,4-dien-2-ol.
| Compound Name | (2E,4E)-5-(1,2,4-oxadiazol-3-yl)hepta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 167046865 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (2E,4E)-5-(1,2,4-oxadiazol-3-yl)hepta-2,4-dien-2-ol |
| SMILES | CC/C(=C\C=C(/C)O)c1ncon1 |
| InChI | InChI=1S/C9H12N2O2/c1-3-8(5-4-7(2)12)9-10-6-13-11-9/h4-6,12H,3H2,1-2H3/b7-4+,8-5+ |
| InChIKey | SYQNOVNSDOQQOY-NSLJXJERSA-N |
| XLogP | 2.32 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|