C10H13F2N2OP — CID 167046907
[(2E,4E)-1,1-difluoro-2-methyl-5-(1,2,4-oxadiazol-3-yl)hepta-2,4-dienyl]phosphane (PubChem CID 167046907) has the molecular formula C10H13F2N2OP and a molecular weight of 246.20 g/mol. Its IUPAC name is [(2E,4E)-1,1-difluoro-2-methyl-5-(1,2,4-oxadiazol-3-yl)hepta-2,4-dienyl]phosphane.
| Compound Name | [(2E,4E)-1,1-difluoro-2-methyl-5-(1,2,4-oxadiazol-3-yl)hepta-2,4-dienyl]phosphane |
|---|---|
| PubChem CID | 167046907 |
| Molecular Formula | C10H13F2N2OP |
| Molecular Weight | 246.20 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | [(2E,4E)-1,1-difluoro-2-methyl-5-(1,2,4-oxadiazol-3-yl)hepta-2,4-dienyl]phosphane |
| SMILES | CC/C(=C\C=C(/C)C(F)(F)P)c1ncon1 |
| InChI | InChI=1S/C10H13F2N2OP/c1-3-8(9-13-6-15-14-9)5-4-7(2)10(11,12)16/h4-6H,3,16H2,1-2H3/b7-4+,8-5+ |
| InChIKey | LNTXYXWAEMUYFE-NSLJXJERSA-N |
| XLogP | 3.28 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|