C15H26NP — CID 167047006
(2E,4E)-N,N,2,5-tetramethyl-6-prop-1-ynylphosphanylocta-2,4-dien-1-amine (PubChem CID 167047006) has the molecular formula C15H26NP and a molecular weight of 251.35 g/mol. Its IUPAC name is (2E,4E)-N,N,2,5-tetramethyl-6-prop-1-ynylphosphanylocta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-N,N,2,5-tetramethyl-6-prop-1-ynylphosphanylocta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 167047006 |
| Molecular Formula | C15H26NP |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | (2E,4E)-N,N,2,5-tetramethyl-6-prop-1-ynylphosphanylocta-2,4-dien-1-amine |
| SMILES | CC#CPC(CC)/C(C)=C/C=C(\C)CN(C)C |
| InChI | InChI=1S/C15H26NP/c1-7-11-17-15(8-2)14(4)10-9-13(3)12-16(5)6/h9-10,15,17H,8,12H2,1-6H3/b13-9+,14-10+ |
| InChIKey | LYKULAMTMWOFGN-UTLPMFLDSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|