About (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole
(2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole (PubChem CID 167047016) has the molecular formula C11H14FN
and a molecular weight of 179.24 g/mol. Its IUPAC name is (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole.
Molecular Properties
| Compound Name | (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole |
| PubChem CID | 167047016 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole |
| SMILES | C=C(F)/C=c1\c(=C/C)cc(C)n1C |
| InChI | InChI=1S/C11H14FN/c1-5-10-7-9(3)13(4)11(10)6-8(2)12/h5-7H,2H2,1,3-4H3/b10-5-,11-6+ |
| InChIKey | SAYAXSKCPVWBOK-JZKFVHIFSA-N |
| XLogP | 1.40 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole?
The IUPAC name of (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole (CID 167047016) is (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole.
What is the SMILES notation for (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole?
The canonical SMILES for (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole is C=C(F)/C=c1\c(=C/C)cc(C)n1C.
What is the InChIKey of (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole?
The InChIKey is SAYAXSKCPVWBOK-JZKFVHIFSA-N. The full InChI is InChI=1S/C11H14FN/c1-5-10-7-9(3)13(4)11(10)6-8(2)12/h5-7H,2H2,1,3-4H3/b10-5-,11-6+.
What are the key properties of (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole?
(2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole has a molecular weight of 179.24 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-3-ethylidene-2-(2-fluoroprop-2-enylidene)-1,5-dimethylpyrrole is sourced from PubChem (CID 167047016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).