C13H20N2 — CID 167047049
N'-methyl-N-[(2E,4Z)-4-methylhepta-2,4,6-trien-2-yl]cyclopropanecarboximidamide (PubChem CID 167047049) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N'-methyl-N-[(2E,4Z)-4-methylhepta-2,4,6-trien-2-yl]cyclopropanecarboximidamide.
| Compound Name | N'-methyl-N-[(2E,4Z)-4-methylhepta-2,4,6-trien-2-yl]cyclopropanecarboximidamide |
|---|---|
| PubChem CID | 167047049 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N'-methyl-N-[(2E,4Z)-4-methylhepta-2,4,6-trien-2-yl]cyclopropanecarboximidamide |
| SMILES | C=C/C=C(C)\C=C(/C)N/C(=N/C)C1CC1 |
| InChI | InChI=1S/C13H20N2/c1-5-6-10(2)9-11(3)15-13(14-4)12-7-8-12/h5-6,9,12H,1,7-8H2,2-4H3,(H,14,15)/b10-6-,11-9+ |
| InChIKey | QHCIPJPSPFTWQD-BZLPTDEHSA-N |
| XLogP | 3.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|