About 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide
2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide (PubChem CID 167047180) has the molecular formula C12H22F3NOS
and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide.
Molecular Properties
| Compound Name | 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide |
| PubChem CID | 167047180 |
| Molecular Formula | C12H22F3NOS |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide |
| SMILES | C=CCCC(CCC(F)(F)F)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22F3NOS/c1-5-6-7-10(8-9-12(13,14)15)16-18(17)11(2,3)4/h5,10,16H,1,6-9H2,2-4H3 |
| InChIKey | APDMBODLSWCUOD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide?
The IUPAC name of 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide (CID 167047180) is 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide.
What is the SMILES notation for 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide?
The canonical SMILES for 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide is C=CCCC(CCC(F)(F)F)NS(=O)C(C)(C)C.
What is the InChIKey of 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide?
The InChIKey is APDMBODLSWCUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NOS/c1-5-6-7-10(8-9-12(13,14)15)16-18(17)11(2,3)4/h5,10,16H,1,6-9H2,2-4H3.
What are the key properties of 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide?
2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide has a molecular weight of 285.38 g/mol, XLogP of 3.72, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(1,1,1-trifluorooct-7-en-4-yl)propane-2-sulfinamide is sourced from PubChem (CID 167047180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).