About but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate
but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate (PubChem CID 167047185) has the molecular formula C10H16N4O
and a molecular weight of 208.26 g/mol. Its IUPAC name is but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate.
Molecular Properties
| Compound Name | but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate |
| PubChem CID | 167047185 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate |
| SMILES | [H]/N=C(\OCCC=C)c1ncnn1C(C)C |
| InChI | InChI=1S/C10H16N4O/c1-4-5-6-15-9(11)10-12-7-13-14(10)8(2)3/h4,7-8,11H,1,5-6H2,2-3H3/b11-9- |
| InChIKey | SAUJDXKYHLFEHT-LUAWRHEFSA-N |
| XLogP | 1.78 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate?
The IUPAC name of but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate (CID 167047185) is but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate.
What is the SMILES notation for but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate?
The canonical SMILES for but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate is [H]/N=C(\OCCC=C)c1ncnn1C(C)C.
What is the InChIKey of but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate?
The InChIKey is SAUJDXKYHLFEHT-LUAWRHEFSA-N. The full InChI is InChI=1S/C10H16N4O/c1-4-5-6-15-9(11)10-12-7-13-14(10)8(2)3/h4,7-8,11H,1,5-6H2,2-3H3/b11-9-.
What are the key properties of but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate?
but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate has a molecular weight of 208.26 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 2-propan-2-yl-1,2,4-triazole-3-carboximidate is sourced from PubChem (CID 167047185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).