About 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate
2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate (PubChem CID 167047200) has the molecular formula C12H17F2N3O
and a molecular weight of 257.28 g/mol. Its IUPAC name is 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate.
Molecular Properties
| Compound Name | 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate |
| PubChem CID | 167047200 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate |
| SMILES | [H]/N=C(\OCC(F)(F)CC=C)c1nccn1C(C)C |
| InChI | InChI=1S/C12H17F2N3O/c1-4-5-12(13,14)8-18-10(15)11-16-6-7-17(11)9(2)3/h4,6-7,9,15H,1,5,8H2,2-3H3/b15-10- |
| InChIKey | UWCKTTNFRKRWTH-GDNBJRDFSA-N |
| XLogP | 3.02 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate?
The IUPAC name of 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate (CID 167047200) is 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate.
What is the SMILES notation for 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate?
The canonical SMILES for 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate is [H]/N=C(\OCC(F)(F)CC=C)c1nccn1C(C)C.
What is the InChIKey of 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate?
The InChIKey is UWCKTTNFRKRWTH-GDNBJRDFSA-N. The full InChI is InChI=1S/C12H17F2N3O/c1-4-5-12(13,14)8-18-10(15)11-16-6-7-17(11)9(2)3/h4,6-7,9,15H,1,5,8H2,2-3H3/b15-10-.
What are the key properties of 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate?
2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate has a molecular weight of 257.28 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoropent-4-enyl 1-propan-2-ylimidazole-2-carboximidate is sourced from PubChem (CID 167047200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).