C19H30F3N5O2 — CID 167047210
[(E,6S)-6-(ethylcarbamoylamino)-9,9,9-trifluoronon-3-enyl] 1-propan-2-ylimidazole-2-carboximidate (PubChem CID 167047210) has the molecular formula C19H30F3N5O2 and a molecular weight of 417.48 g/mol. Its IUPAC name is [(E,6S)-6-(ethylcarbamoylamino)-9,9,9-trifluoronon-3-enyl] 1-propan-2-ylimidazole-2-carboximidate.
| Compound Name | [(E,6S)-6-(ethylcarbamoylamino)-9,9,9-trifluoronon-3-enyl] 1-propan-2-ylimidazole-2-carboximidate |
|---|---|
| PubChem CID | 167047210 |
| Molecular Formula | C19H30F3N5O2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | [(E,6S)-6-(ethylcarbamoylamino)-9,9,9-trifluoronon-3-enyl] 1-propan-2-ylimidazole-2-carboximidate |
| SMILES | [H]/N=C(\OCC/C=C/C[C@H](CCC(F)(F)F)NC(=O)NCC)c1nccn1C(C)C |
| InChI | InChI=1S/C19H30F3N5O2/c1-4-24-18(28)26-15(9-10-19(20,21)22)8-6-5-7-13-29-16(23)17-25-11-12-27(17)14(2)3/h5-6,11-12,14-15,23H,4,7-10,13H2,1-3H3,(H2,24,26,28)/b6-5+,23-16-/t15-/m1/s1 |
| InChIKey | ZEXXJYGUKPRRAI-XIMLCZNCSA-N |
| XLogP | 4.17 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|