C18H26F3N5O2 — CID 167047265
but-3-enyl 1-[ethyl-[[(4S)-7,7,7-trifluorohept-1-en-4-yl]carbamoyl]amino]imidazole-2-carboximidate (PubChem CID 167047265) has the molecular formula C18H26F3N5O2 and a molecular weight of 401.43 g/mol. Its IUPAC name is but-3-enyl 1-[ethyl-[[(4S)-7,7,7-trifluorohept-1-en-4-yl]carbamoyl]amino]imidazole-2-carboximidate.
| Compound Name | but-3-enyl 1-[ethyl-[[(4S)-7,7,7-trifluorohept-1-en-4-yl]carbamoyl]amino]imidazole-2-carboximidate |
|---|---|
| PubChem CID | 167047265 |
| Molecular Formula | C18H26F3N5O2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | but-3-enyl 1-[ethyl-[[(4S)-7,7,7-trifluorohept-1-en-4-yl]carbamoyl]amino]imidazole-2-carboximidate |
| SMILES | [H]/N=C(\OCCC=C)c1nccn1N(CC)C(=O)N[C@H](CC=C)CCC(F)(F)F |
| InChI | InChI=1S/C18H26F3N5O2/c1-4-7-13-28-15(22)16-23-11-12-26(16)25(6-3)17(27)24-14(8-5-2)9-10-18(19,20)21/h4-5,11-12,14,22H,1-2,6-10,13H2,3H3,(H,24,27)/b22-15-/t14-/m1/s1 |
| InChIKey | LENLSQGQIIOGME-HHSBIGSDSA-N |
| XLogP | 3.76 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|