C19H35N3 — CID 167047783
N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2,2-dimethylpentan-3-amine (PubChem CID 167047783) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2,2-dimethylpentan-3-amine.
| Compound Name | N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2,2-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 167047783 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]-2,2-dimethylpentan-3-amine |
| SMILES | [H]/N=C(\C=C(/NC(CC)C(C)(C)C)C(=C)C)N1CCCCC1C |
| InChI | InChI=1S/C19H35N3/c1-8-17(19(5,6)7)21-16(14(2)3)13-18(20)22-12-10-9-11-15(22)4/h13,15,17,20-21H,2,8-12H2,1,3-7H3/b16-13-,20-18+ |
| InChIKey | QJFHBLGHMCMGCJ-MGLDXCJPSA-N |
| XLogP | 4.71 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|