C16H30N4 — CID 167047790
2-N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]butane-1,2-diamine (PubChem CID 167047790) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]butane-1,2-diamine.
| Compound Name | 2-N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]butane-1,2-diamine |
|---|---|
| PubChem CID | 167047790 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 2-N-[(3Z)-5-imino-2-methyl-5-(2-methylpiperidin-1-yl)penta-1,3-dien-3-yl]butane-1,2-diamine |
| SMILES | [H]/N=C(\C=C(/NC(CC)CN)C(=C)C)N1CCCCC1C |
| InChI | InChI=1S/C16H30N4/c1-5-14(11-17)19-15(12(2)3)10-16(18)20-9-7-6-8-13(20)4/h10,13-14,18-19H,2,5-9,11,17H2,1,3-4H3/b15-10-,18-16+ |
| InChIKey | VGIPNSMVRJFKBO-KSKMTBSBSA-N |
| XLogP | 2.62 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|