C18H29N3 — CID 167047806
(2Z)-2-(5,5-dimethyl-3-methylidene-1,4,4a,6,7,7a-hexahydrocyclopenta[b]pyridin-2-ylidene)-1-(2-methylpyrrolidin-1-yl)ethanimine (PubChem CID 167047806) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is (2Z)-2-(5,5-dimethyl-3-methylidene-1,4,4a,6,7,7a-hexahydrocyclopenta[b]pyridin-2-ylidene)-1-(2-methylpyrrolidin-1-yl)ethanimine.
| Compound Name | (2Z)-2-(5,5-dimethyl-3-methylidene-1,4,4a,6,7,7a-hexahydrocyclopenta[b]pyridin-2-ylidene)-1-(2-methylpyrrolidin-1-yl)ethanimine |
|---|---|
| PubChem CID | 167047806 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | (2Z)-2-(5,5-dimethyl-3-methylidene-1,4,4a,6,7,7a-hexahydrocyclopenta[b]pyridin-2-ylidene)-1-(2-methylpyrrolidin-1-yl)ethanimine |
| SMILES | [H]/N=C(/C=C1\NC2CCC(C)(C)C2CC1=C)N1CCCC1C |
| InChI | InChI=1S/C18H29N3/c1-12-10-14-15(7-8-18(14,3)4)20-16(12)11-17(19)21-9-5-6-13(21)2/h11,13-15,19-20H,1,5-10H2,2-4H3/b16-11-,19-17- |
| InChIKey | ZWCVIVPVBLLIRV-WNMDQABESA-N |
| XLogP | 3.69 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|