About (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol
(1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol (PubChem CID 167048183) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol.
Molecular Properties
| Compound Name | (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol |
| PubChem CID | 167048183 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol |
| SMILES | CN1CCC2(CC1)Cc1ccc(CO)cc1C2 |
| InChI | InChI=1S/C15H21NO/c1-16-6-4-15(5-7-16)9-13-3-2-12(11-17)8-14(13)10-15/h2-3,8,17H,4-7,9-11H2,1H3 |
| InChIKey | FOXJXNBQDLKUCY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol?
The IUPAC name of (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol (CID 167048183) is (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol.
What is the SMILES notation for (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol?
The canonical SMILES for (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol is CN1CCC2(CC1)Cc1ccc(CO)cc1C2.
What is the InChIKey of (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol?
The InChIKey is FOXJXNBQDLKUCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-16-6-4-15(5-7-16)9-13-3-2-12(11-17)8-14(13)10-15/h2-3,8,17H,4-7,9-11H2,1H3.
What are the key properties of (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol?
(1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol has a molecular weight of 231.34 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1'-methylspiro[1,3-dihydroindene-2,4'-piperidine]-5-yl)methanol is sourced from PubChem (CID 167048183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).