About (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine
(2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine (PubChem CID 167048811) has the molecular formula C16H30FN
and a molecular weight of 255.42 g/mol. Its IUPAC name is (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine.
Molecular Properties
| Compound Name | (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine |
| PubChem CID | 167048811 |
| Molecular Formula | C16H30FN |
| Molecular Weight | 255.42 g/mol |
| Exact Mass | 255.24 |
| IUPAC Name | (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine |
| SMILES | C/C=C(/N)CC/C=C(/CF)C(C)(CC)CCCC |
| InChI | InChI=1S/C16H30FN/c1-5-8-12-16(4,7-3)14(13-17)10-9-11-15(18)6-2/h6,10H,5,7-9,11-13,18H2,1-4H3/b14-10-,15-6+ |
| InChIKey | FJSSONNRSBAKTI-ZZPDRKNWSA-N |
| XLogP | 5.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine?
The IUPAC name of (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine (CID 167048811) is (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine.
What is the SMILES notation for (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine?
The canonical SMILES for (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine is C/C=C(/N)CC/C=C(/CF)C(C)(CC)CCCC.
What is the InChIKey of (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine?
The InChIKey is FJSSONNRSBAKTI-ZZPDRKNWSA-N. The full InChI is InChI=1S/C16H30FN/c1-5-8-12-16(4,7-3)14(13-17)10-9-11-15(18)6-2/h6,10H,5,7-9,11-13,18H2,1-4H3/b14-10-,15-6+.
What are the key properties of (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine?
(2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine has a molecular weight of 255.42 g/mol, XLogP of 5.13, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6E)-8-ethyl-7-(fluoromethyl)-8-methyldodeca-2,6-dien-3-amine is sourced from PubChem (CID 167048811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).