About 2-[2,2-difluoroethyl(sulfamoyl)amino]propane
2-[2,2-difluoroethyl(sulfamoyl)amino]propane (PubChem CID 167049037) has the molecular formula C5H12F2N2O2S
and a molecular weight of 202.23 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(sulfamoyl)amino]propane.
Molecular Properties
| Compound Name | 2-[2,2-difluoroethyl(sulfamoyl)amino]propane |
| PubChem CID | 167049037 |
| Molecular Formula | C5H12F2N2O2S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-[2,2-difluoroethyl(sulfamoyl)amino]propane |
| SMILES | CC(C)N(CC(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C5H12F2N2O2S/c1-4(2)9(3-5(6)7)12(8,10)11/h4-5H,3H2,1-2H3,(H2,8,10,11) |
| InChIKey | LBNMPDWWNGGOJZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2,2-difluoroethyl(sulfamoyl)amino]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoroethyl(sulfamoyl)amino]propane?
The IUPAC name of 2-[2,2-difluoroethyl(sulfamoyl)amino]propane (CID 167049037) is 2-[2,2-difluoroethyl(sulfamoyl)amino]propane.
What is the SMILES notation for 2-[2,2-difluoroethyl(sulfamoyl)amino]propane?
The canonical SMILES for 2-[2,2-difluoroethyl(sulfamoyl)amino]propane is CC(C)N(CC(F)F)S(N)(=O)=O.
What is the InChIKey of 2-[2,2-difluoroethyl(sulfamoyl)amino]propane?
The InChIKey is LBNMPDWWNGGOJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12F2N2O2S/c1-4(2)9(3-5(6)7)12(8,10)11/h4-5H,3H2,1-2H3,(H2,8,10,11).
What are the key properties of 2-[2,2-difluoroethyl(sulfamoyl)amino]propane?
2-[2,2-difluoroethyl(sulfamoyl)amino]propane has a molecular weight of 202.23 g/mol, XLogP of 0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoroethyl(sulfamoyl)amino]propane is sourced from PubChem (CID 167049037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).