C5H11F3N2O3S — CID 167049288
3-[ethyl(sulfamoyl)amino]-1,1,1-trifluoro-2-hydroxypropane (PubChem CID 167049288) has the molecular formula C5H11F3N2O3S and a molecular weight of 236.21 g/mol. Its IUPAC name is 3-[ethyl(sulfamoyl)amino]-1,1,1-trifluoro-2-hydroxypropane.
| Compound Name | 3-[ethyl(sulfamoyl)amino]-1,1,1-trifluoro-2-hydroxypropane |
|---|---|
| PubChem CID | 167049288 |
| Molecular Formula | C5H11F3N2O3S |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-[ethyl(sulfamoyl)amino]-1,1,1-trifluoro-2-hydroxypropane |
| SMILES | CCN(CC(O)C(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C5H11F3N2O3S/c1-2-10(14(9,12)13)3-4(11)5(6,7)8/h4,11H,2-3H2,1H3,(H2,9,12,13) |
| InChIKey | UHWMPTVEPHWFKR-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |