About 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one
4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one (PubChem CID 167049344) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one |
| PubChem CID | 167049344 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one |
| SMILES | CCc1ncnc2cn(C)c(=O)cc12 |
| InChI | InChI=1S/C10H11N3O/c1-3-8-7-4-10(14)13(2)5-9(7)12-6-11-8/h4-6H,3H2,1-2H3 |
| InChIKey | IJAZUPKAWRJNQP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one?
The IUPAC name of 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one (CID 167049344) is 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one.
What is the SMILES notation for 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one?
The canonical SMILES for 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one is CCc1ncnc2cn(C)c(=O)cc12.
What is the InChIKey of 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one?
The InChIKey is IJAZUPKAWRJNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-3-8-7-4-10(14)13(2)5-9(7)12-6-11-8/h4-6H,3H2,1-2H3.
What are the key properties of 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one?
4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one has a molecular weight of 189.22 g/mol, XLogP of 0.89, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-7-methylpyrido[3,4-d]pyrimidin-6-one is sourced from PubChem (CID 167049344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).