C22H27N7O2 — CID 167049831
trans-(1S,2S)-2-[[2-[(2-methoxy-6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)amino]pyrido[3,4-d]pyrimidin-8-yl]amino]cyclopentan-1-ol (PubChem CID 167049831) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[2-[(2-methoxy-6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)amino]pyrido[3,4-d]pyrimidin-8-yl]amino]cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-[[2-[(2-methoxy-6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)amino]pyrido[3,4-d]pyrimidin-8-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 167049831 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | trans-(1S,2S)-2-[[2-[(2-methoxy-6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)amino]pyrido[3,4-d]pyrimidin-8-yl]amino]cyclopentan-1-ol |
| SMILES | COc1nc2c(cc1Nc1ncc3ccnc(N[C@H]4CCC[C@@H]4O)c3n1)CN(C)CC2 |
| InChI | InChI=1S/C22H27N7O2/c1-29-9-7-15-14(12-29)10-17(21(26-15)31-2)27-22-24-11-13-6-8-23-20(19(13)28-22)25-16-4-3-5-18(16)30/h6,8,10-11,16,18,30H,3-5,7,9,12H2,1-2H3,(H,23,25)(H,24,27,28)/t16-,18-/m0/s1 |
| InChIKey | UWBUZQOMODMARP-WMZOPIPTSA-N |
| XLogP | 2.49 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |