C23H32O5 — CID 167049955
[(1S,2R,3S,4S,6R,7R)-4-ethenyl-4-ethynyl-3,10-dihydroxy-2,7,14-trimethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate (PubChem CID 167049955) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R)-4-ethenyl-4-ethynyl-3,10-dihydroxy-2,7,14-trimethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R)-4-ethenyl-4-ethynyl-3,10-dihydroxy-2,7,14-trimethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 167049955 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R)-4-ethenyl-4-ethynyl-3,10-dihydroxy-2,7,14-trimethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate |
| SMILES | C#C[C@@]1(C=C)C[C@@H](OC(=O)CO)[C@@]2(C)C3=CC(O)C[C@@]3(CCC2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C23H32O5/c1-6-22(7-2)12-18(28-19(26)13-24)21(5)14(3)8-9-23(15(4)20(22)27)11-16(25)10-17(21)23/h1,7,10,14-16,18,20,24-25,27H,2,8-9,11-13H2,3-5H3/t14?,15-,16?,18+,20-,21+,22+,23-/m0/s1 |
| InChIKey | IBVIQVMFHNODEO-WDWHUAJBSA-N |
| XLogP | 2.21 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|