C22H34O4 — CID 167049963
[(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradeca-8,10-dienyl] 2-hydroxyacetate (PubChem CID 167049963) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradeca-8,10-dienyl] 2-hydroxyacetate.
| Compound Name | [(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradeca-8,10-dienyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 167049963 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradeca-8,10-dienyl] 2-hydroxyacetate |
| SMILES | CC[C@]1(C)C[C@@H](OC(=O)CO)[C@@]2(C)C3=CC=C[C@@]3(CC[C@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C22H34O4/c1-6-20(4)12-17(26-18(24)13-23)21(5)14(2)9-11-22(15(3)19(20)25)10-7-8-16(21)22/h7-8,10,14-15,17,19,23,25H,6,9,11-13H2,1-5H3/t14-,15+,17-,19+,20-,21-,22-/m1/s1 |
| InChIKey | DCOOISSZTAKXDD-ITFSIJJYSA-N |
| XLogP | 3.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |