C18H15N5 — CID 167050190
N-[(4-pyrazol-1-ylphenyl)methyl]-1,6-naphthyridin-2-amine (PubChem CID 167050190) has the molecular formula C18H15N5 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[(4-pyrazol-1-ylphenyl)methyl]-1,6-naphthyridin-2-amine.
| Compound Name | N-[(4-pyrazol-1-ylphenyl)methyl]-1,6-naphthyridin-2-amine |
|---|---|
| PubChem CID | 167050190 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[(4-pyrazol-1-ylphenyl)methyl]-1,6-naphthyridin-2-amine |
| SMILES | c1cnn(-c2ccc(CNc3ccc4cnccc4n3)cc2)c1 |
| InChI | InChI=1S/C18H15N5/c1-9-21-23(11-1)16-5-2-14(3-6-16)12-20-18-7-4-15-13-19-10-8-17(15)22-18/h1-11,13H,12H2,(H,20,22) |
| InChIKey | FCPDHWOEOKLJHB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |