About 2-naphthalen-2-yloxy-1,7-naphthyridine
2-naphthalen-2-yloxy-1,7-naphthyridine (PubChem CID 167050226) has the molecular formula C18H12N2O
and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-naphthalen-2-yloxy-1,7-naphthyridine.
Molecular Properties
| Compound Name | 2-naphthalen-2-yloxy-1,7-naphthyridine |
| PubChem CID | 167050226 |
| Molecular Formula | C18H12N2O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-naphthalen-2-yloxy-1,7-naphthyridine |
| SMILES | c1ccc2cc(Oc3ccc4ccncc4n3)ccc2c1 |
| InChI | InChI=1S/C18H12N2O/c1-2-4-15-11-16(7-5-13(15)3-1)21-18-8-6-14-9-10-19-12-17(14)20-18/h1-12H |
| InChIKey | KSVVSPSLYNSMJC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-naphthalen-2-yloxy-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-2-yloxy-1,7-naphthyridine?
The IUPAC name of 2-naphthalen-2-yloxy-1,7-naphthyridine (CID 167050226) is 2-naphthalen-2-yloxy-1,7-naphthyridine.
What is the SMILES notation for 2-naphthalen-2-yloxy-1,7-naphthyridine?
The canonical SMILES for 2-naphthalen-2-yloxy-1,7-naphthyridine is c1ccc2cc(Oc3ccc4ccncc4n3)ccc2c1.
What is the InChIKey of 2-naphthalen-2-yloxy-1,7-naphthyridine?
The InChIKey is KSVVSPSLYNSMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O/c1-2-4-15-11-16(7-5-13(15)3-1)21-18-8-6-14-9-10-19-12-17(14)20-18/h1-12H.
What are the key properties of 2-naphthalen-2-yloxy-1,7-naphthyridine?
2-naphthalen-2-yloxy-1,7-naphthyridine has a molecular weight of 272.31 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-2-yloxy-1,7-naphthyridine is sourced from PubChem (CID 167050226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).