About CID 167050465
CID 167050465 (PubChem CID 167050465) has the molecular formula C32H24N6O2S2
and a molecular weight of 588.72 g/mol.
Molecular Properties
| Compound Name | CID 167050465 |
| PubChem CID | 167050465 |
| Molecular Formula | C32H24N6O2S2 |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | — |
| SMILES | N#CC(C#N)=Nc1cc2c(s1)-c1cc3c(cc1OC21CCCCC1)-c1sc(N=C(C#N)C#N)cc1C1(CCCCC1)O3 |
| InChI | InChI=1S/C32H24N6O2S2/c33-15-19(16-34)37-27-13-23-29(41-27)21-12-26-22(11-25(21)39-31(23)7-3-1-4-8-31)30-24(32(40-26)9-5-2-6-10-32)14-28(42-30)38-20(17-35)18-36/h11-14H,1-10H2 |
| InChIKey | VZSCIADNQSNERK-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 138.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 167050465 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167050465?
The IUPAC name of CID 167050465 (CID 167050465) is not available.
What is the SMILES notation for CID 167050465?
The canonical SMILES for CID 167050465 is N#CC(C#N)=Nc1cc2c(s1)-c1cc3c(cc1OC21CCCCC1)-c1sc(N=C(C#N)C#N)cc1C1(CCCCC1)O3.
What is the InChIKey of CID 167050465?
The InChIKey is VZSCIADNQSNERK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H24N6O2S2/c33-15-19(16-34)37-27-13-23-29(41-27)21-12-26-22(11-25(21)39-31(23)7-3-1-4-8-31)30-24(32(40-26)9-5-2-6-10-32)14-28(42-30)38-20(17-35)18-36/h11-14H,1-10H2.
What are the key properties of CID 167050465?
CID 167050465 has a molecular weight of 588.72 g/mol, XLogP of 8.49, 2 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167050465 is sourced from PubChem (CID 167050465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).