About CID 167050664
CID 167050664 (PubChem CID 167050664) has the molecular formula C40H28N4S5
and a molecular weight of 725.03 g/mol.
Molecular Properties
| Compound Name | CID 167050664 |
| PubChem CID | 167050664 |
| Molecular Formula | C40H28N4S5 |
| Molecular Weight | 725.03 g/mol |
| Exact Mass | 724.09 |
| IUPAC Name | — |
| SMILES | N#CC(C#N)=Cc1ccc(C2=Cc3sc4c(c3C23CCCCC3)C2(CCCCC2)c2c-4sc3cc(-c4ccc(C=C(C#N)C#N)s4)sc23)s1 |
| InChI | InChI=1S/C40H28N4S5/c41-19-23(20-42)15-25-7-9-28(45-25)27-17-31-33(39(27)11-3-1-4-12-39)34-37(48-31)38-35(40(34)13-5-2-6-14-40)36-32(49-38)18-30(47-36)29-10-8-26(46-29)16-24(21-43)22-44/h7-10,15-18H,1-6,11-14H2 |
| InChIKey | XSDCAFHLLFVUBJ-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 725.03 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze CID 167050664 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167050664?
The IUPAC name of CID 167050664 (CID 167050664) is not available.
What is the SMILES notation for CID 167050664?
The canonical SMILES for CID 167050664 is N#CC(C#N)=Cc1ccc(C2=Cc3sc4c(c3C23CCCCC3)C2(CCCCC2)c2c-4sc3cc(-c4ccc(C=C(C#N)C#N)s4)sc23)s1.
What is the InChIKey of CID 167050664?
The InChIKey is XSDCAFHLLFVUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H28N4S5/c41-19-23(20-42)15-25-7-9-28(45-25)27-17-31-33(39(27)11-3-1-4-12-39)34-37(48-31)38-35(40(34)13-5-2-6-14-40)36-32(49-38)18-30(47-36)29-10-8-26(46-29)16-24(21-43)22-44/h7-10,15-18H,1-6,11-14H2.
What are the key properties of CID 167050664?
CID 167050664 has a molecular weight of 725.03 g/mol, XLogP of 12.66, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167050664 is sourced from PubChem (CID 167050664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).